CAS 24706-49-8 appears in our catalog under these names: 5,5-Dimethyl-3-((4-nitrophenyl)amino)cyclohex-2-en-1-one, 95-<97%, 5,5-Dimethyl-3-((4-nitrophenyl)amino)cyclohex-2-en-1-one, ≥97-<99%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
5,5-dimethyl-3-(4-nitroanilino)cyclohex-2-en-1-one (CAS 24706-49-8) is a chemical compound with the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. IUPAC name: 5,5-dimethyl-3-(4-nitroanilino)cyclohex-2-en-1-one. InChIKey: YAUMXBXKBGPOJL-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O3 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | 5,5-dimethyl-3-(4-nitroanilino)cyclohex-2-en-1-one |
| InChIKey | YAUMXBXKBGPOJL-UHFFFAOYSA-N |
| SMILES | CC1(CC(=CC(=O)C1)NC2=CC=C(C=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)