CAS 247109-15-5 appears in our catalog under these names: 5–(3–Methoxyphenyl)–1,3,4–thiadiazol–2–amine, 2-Amino-5-(3-methoxyphenyl)-1,3,4-thiadiazole, 5-(3-Methoxyphenyl)-1,3,4-thiadiazol-2-amine, 97%, 97%, 5-(3-METHOXYPHENYL)-1,3,4-THIADIAZOL-2-AMINE, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 250mg, 100g, 25g.
5-(3-methoxyphenyl)-1,3,4-thiadiazol-2-amine (CAS 247109-15-5) is a chemical compound with the molecular formula C9H9N3OS and a molecular weight of 207.25 g/mol. IUPAC name: 5-(3-methoxyphenyl)-1,3,4-thiadiazol-2-amine. InChIKey: ANOZGAXEWJZHBU-UHFFFAOYSA-N.
| Molecular formula | C9H9N3OS |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 5-(3-methoxyphenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | ANOZGAXEWJZHBU-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=NN=C(S2)N |
Computed by PubChem (NCBI)