CAS 24715-41-1 is the registry number for 3-(phenylamino)inden-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
3-anilinoinden-1-one (CAS 24715-41-1) is a chemical compound with the molecular formula C15H11NO and a molecular weight of 221.25 g/mol. IUPAC name: 3-anilinoinden-1-one. InChIKey: HLXOWZSHMUMIGG-UHFFFAOYSA-N.
| Molecular formula | C15H11NO |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 3-anilinoinden-1-one |
| InChIKey | HLXOWZSHMUMIGG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC(=O)C3=CC=CC=C32 |
Computed by PubChem (NCBI)