CAS 24767-64-4 appears in our catalog under these names: (2,2-dimethyloxetan-3-yl) 4-methylbenzenesulfonate, 95%, (2,2-dimethyloxetan-3-yl) 4-methylbenzenesulfonate, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
(2,2-dimethyloxetan-3-yl) 4-methylbenzenesulfonate (CAS 24767-64-4) is a chemical compound with the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. IUPAC name: (2,2-dimethyloxetan-3-yl) 4-methylbenzenesulfonate. InChIKey: YLQDRYMIRQBTNK-UHFFFAOYSA-N.
| Molecular formula | C12H16O4S |
|---|---|
| Molecular weight | 256.32 g/mol |
| IUPAC name | (2,2-dimethyloxetan-3-yl) 4-methylbenzenesulfonate |
| InChIKey | YLQDRYMIRQBTNK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2COC2(C)C |
Computed by PubChem (NCBI)