CAS 2482-25-9 appears in our catalog under these names: 4-Hydroxy-Bz-Gly-OH, 97%, 4-Hydroxyhippuric Acid, >95% (HPLC), 4–Hydroxy–hippuric acid, p-Hydroxyhippuric acid, 4-OH-Hippuric acid 98%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 10g, 25g, 5g, 1g, 25mg, 50mg, 0,5g, 2g.
P-hydroxyhippuric acid is an N-acylglycine that is the 4-hydroxy derivative of hippuric acid. It has a role as a human blood serum metabolite. It is functionally related to a N-benzoylglycine. It is a conjugate acid of a p-hydroxyhippurate.
Source: ChEBI
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2-[(4-hydroxybenzoyl)amino]acetic acid |
| InChIKey | ZMHLUFWWWPBTIU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NCC(=O)O)O |
Computed by PubChem (NCBI)