Products 24866-79-3
CAS 24866-79-3 appears in our catalog under these names: 3-((4-Chlorophenyl)methyl)piperidine-2,6-dione, 3-((4-Chlorophenyl)methyl)piperidine-2,6-dione, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.
3-[(4-chlorophenyl)methyl]piperidine-2,6-dione (CAS 24866-79-3) is a chemical compound with the molecular formula C12H12ClNO2 and a molecular weight of 237.68 g/mol. IUPAC name: 3-[(4-chlorophenyl)methyl]piperidine-2,6-dione. InChIKey: PNPLYIUMWFHECA-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO2 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | 3-[(4-chlorophenyl)methyl]piperidine-2,6-dione |
| InChIKey | PNPLYIUMWFHECA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1CC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)