CAS 2495-92-3 appears in our catalog under these names: 6-Benzyloxy-5-methoxyindole-2-carboxylic Acid, >95% (HPLC), 6-Benzyloxy-5-methoxyindole-2-carboxylic acid, 6-(Benzyloxy)-5-methoxy-1H-indole-2-carboxylic acid 95%, 6-Benzyloxy-5-methoxyindole-2-carboxylic acid, 95%, 95%, 6-Benzyloxy-5-methoxy-1H-indole-2-carboxylic acid, 95%. Offered by: TRC, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 50mg, 1g.
5-methoxy-6-phenylmethoxy-1H-indole-2-carboxylic acid (CAS 2495-92-3) is a chemical compound with the molecular formula C17H15NO4 and a molecular weight of 297.30 g/mol. IUPAC name: 5-methoxy-6-phenylmethoxy-1H-indole-2-carboxylic acid. InChIKey: JMOOGCFXFNKYCS-UHFFFAOYSA-N.
| Molecular formula | C17H15NO4 |
|---|---|
| Molecular weight | 297.30 g/mol |
| IUPAC name | 5-methoxy-6-phenylmethoxy-1H-indole-2-carboxylic acid |
| InChIKey | JMOOGCFXFNKYCS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=C(N2)C(=O)O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)