Products 2502205-56-1
CAS 2502205-56-1 is the registry number for tert-Butyl 5-bromo-1H-indole-2-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
Tert-butyl 5-bromo-1H-indole-2-carboxylate (CAS 2502205-56-1) is a chemical compound with the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. IUPAC name: tert-butyl 5-bromo-1H-indole-2-carboxylate. InChIKey: WUIWNDORCLOWBB-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO2 |
|---|---|
| Molecular weight | 296.16 g/mol |
| IUPAC name | tert-butyl 5-bromo-1H-indole-2-carboxylate |
| InChIKey | WUIWNDORCLOWBB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC2=C(N1)C=CC(=C2)Br |
Computed by PubChem (NCBI)