Products 2504915-16-4
CAS 2504915-16-4 is the registry number for tert-Butyl 4-(3-formyl-4-(methoxycarbonyl)phenyl)piperazine-1-carboxylate, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Tert-butyl 4-(3-formyl-4-methoxycarbonylphenyl)piperazine-1-carboxylate (CAS 2504915-16-4) is a chemical compound with the molecular formula C18H24N2O5 and a molecular weight of 348.4 g/mol. IUPAC name: tert-butyl 4-(3-formyl-4-methoxycarbonylphenyl)piperazine-1-carboxylate. InChIKey: SUSQNUJVENODIL-UHFFFAOYSA-N.
| Molecular formula | C18H24N2O5 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | tert-butyl 4-(3-formyl-4-methoxycarbonylphenyl)piperazine-1-carboxylate |
| InChIKey | SUSQNUJVENODIL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC(=C(C=C2)C(=O)OC)C=O |
Computed by PubChem (NCBI)