Products 250714-64-8

CAS 250714-64-8 appears in our catalog under these names: 2–(4–Fluoro–benzenesulfonylamino)–propionic acid, 2-(4-Fluorobenzenesulfonamido)propanoic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 2,5g.

Structural formula: {0} (CAS {1})

2-[(4-fluorophenyl)sulfonylamino]propanoic acid (CAS 250714-64-8) is a chemical compound with the molecular formula C9H10FNO4S and a molecular weight of 247.25 g/mol. IUPAC name: 2-[(4-fluorophenyl)sulfonylamino]propanoic acid. InChIKey: JOYNOYIEQOCUEJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10FNO4S
Molecular weight247.25 g/mol
IUPAC name2-[(4-fluorophenyl)sulfonylamino]propanoic acid
InChIKeyJOYNOYIEQOCUEJ-UHFFFAOYSA-N
SMILESCC(C(=O)O)NS(=O)(=O)C1=CC=C(C=C1)F

Computed by PubChem (NCBI)