Products 2509135-74-2
CAS 2509135-74-2 is the registry number for Cyclopropyl[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanone, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Cyclopropyl-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanone (CAS 2509135-74-2) is a chemical compound with the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. IUPAC name: cyclopropyl-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanone. InChIKey: SEAUUICTWPWJRX-UHFFFAOYSA-N.
| Molecular formula | C11H10F3NO2 |
|---|---|
| Molecular weight | 245.20 g/mol |
| IUPAC name | cyclopropyl-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanone |
| InChIKey | SEAUUICTWPWJRX-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=CN=C(C=C2)OCC(F)(F)F |
Computed by PubChem (NCBI)