Products 2512202-12-7
CAS 2512202-12-7 is the registry number for 4-Isopropylphenyl Diphenyl Phosphate-d10. Offered by: MedChemExpress. Available pack sizes: 2.5 mg, 5 mg.
Bis(2,3,4,5,6-pentadeuteriophenyl) (4-propan-2-ylphenyl) phosphate (CAS 2512202-12-7) is a chemical compound with the molecular formula C21H21O4P and a molecular weight of 378.4 g/mol. IUPAC name: bis(2,3,4,5,6-pentadeuteriophenyl) (4-propan-2-ylphenyl) phosphate. InChIKey: JUHFQCKQQLMGAB-HZKWNVQXSA-N.
| Molecular formula | C21H21O4P |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | bis(2,3,4,5,6-pentadeuteriophenyl) (4-propan-2-ylphenyl) phosphate |
| InChIKey | JUHFQCKQQLMGAB-HZKWNVQXSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])OP(=O)(OC2=CC=C(C=C2)C(C)C)OC3=C(C(=C(C(=C3[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)