Products 2512223-53-7
CAS 2512223-53-7 is the registry number for 3-(3,5-Dichlorophenyl)tetrahydro-3-furanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(3,5-dichlorophenyl)oxolan-3-ol (CAS 2512223-53-7) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: 3-(3,5-dichlorophenyl)oxolan-3-ol. InChIKey: DWNFZWXAZZOVPV-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 3-(3,5-dichlorophenyl)oxolan-3-ol |
| InChIKey | DWNFZWXAZZOVPV-UHFFFAOYSA-N |
| SMILES | C1COCC1(C2=CC(=CC(=C2)Cl)Cl)O |
Computed by PubChem (NCBI)