CAS 25158-78-5 is the registry number for 3-(4-Bromophenyl)cyclohexanone. Offered by: TRC. Available pack sizes: 2,5g.
3-(4-bromophenyl)cyclohexan-1-one (CAS 25158-78-5) is a chemical compound with the molecular formula C12H13BrO and a molecular weight of 253.13 g/mol. IUPAC name: 3-(4-bromophenyl)cyclohexan-1-one. InChIKey: OWJFSGNEZCNGJL-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO |
|---|---|
| Molecular weight | 253.13 g/mol |
| IUPAC name | 3-(4-bromophenyl)cyclohexan-1-one |
| InChIKey | OWJFSGNEZCNGJL-UHFFFAOYSA-N |
| SMILES | C1CC(CC(=O)C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)