Products 25227-37-6
CAS 25227-37-6 is the registry number for 2-((1E)-1,2,3,4-Tetrahydronaphthalen-1-ylidene)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2E)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid (CAS 25227-37-6) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: (2E)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid. InChIKey: BZGRNCRWQYXYAG-CSKARUKUSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | (2E)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid |
| InChIKey | BZGRNCRWQYXYAG-CSKARUKUSA-N |
| SMILES | C1CC2=CC=CC=C2/C(=C/C(=O)O)/C1 |
Computed by PubChem (NCBI)