CAS 253677-29-1 appears in our catalog under these names: 2–((tert–Butoxycarbonyl)amino)–5–chlorobenzoic acid, 2-((tert-Butoxycarbonyl)amino)-5-chlorobenzoic acid, 97%, 97%, N-Boc-5-Chloroanthranilic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g.
5-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 253677-29-1) is a chemical compound with the molecular formula C12H14ClNO4 and a molecular weight of 271.69 g/mol. IUPAC name: 5-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: SWJIXFKVVPTMPQ-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO4 |
|---|---|
| Molecular weight | 271.69 g/mol |
| IUPAC name | 5-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | SWJIXFKVVPTMPQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)