CAS 25369-31-7 appears in our catalog under these names: 7-Nitrooxindole, 96%, 7-Nitroindolin-2-one 97%, 7-Nitroindolin-2-one, 97%, 97%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 10g.
7-nitro-1,3-dihydroindol-2-one (CAS 25369-31-7) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 7-nitro-1,3-dihydroindol-2-one. InChIKey: VGANBSWHOYEFKJ-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 7-nitro-1,3-dihydroindol-2-one |
| InChIKey | VGANBSWHOYEFKJ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)[N+](=O)[O-])NC1=O |
Computed by PubChem (NCBI)