Products 25369-43-1
CAS 25369-43-1 appears in our catalog under these names: 2–Oxoindoline–7–carboxylic acid, 2-oxo-Indoline-7-carboxylic acid, 2-Oxoindoline-7-carboxylic acid 95%, 2-Oxoindoline-7-carboxylic acid, 95%, 95%, 2-OXO-INDOLINE-7-CARBOXYLIC ACID, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 0,5g, 50mg.
2-oxo-1,3-dihydroindole-7-carboxylic acid (CAS 25369-43-1) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 2-oxo-1,3-dihydroindole-7-carboxylic acid. InChIKey: KKDOVZSOSPBZIF-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 2-oxo-1,3-dihydroindole-7-carboxylic acid |
| InChIKey | KKDOVZSOSPBZIF-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)C(=O)O)NC1=O |
Computed by PubChem (NCBI)