CAS 25394-24-5 is the registry number for rac-Chloroephedrine HCl (Mixture of Diastereomers). Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-N-methyl-1-phenylpropan-2-amine;hydrochloride (CAS 25394-24-5) is a chemical compound with the molecular formula C10H15Cl2N and a molecular weight of 220.14 g/mol. IUPAC name: 1-chloro-N-methyl-1-phenylpropan-2-amine;hydrochloride. InChIKey: ICZRAESMLGJTOQ-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2N |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 1-chloro-N-methyl-1-phenylpropan-2-amine;hydrochloride |
| InChIKey | ICZRAESMLGJTOQ-UHFFFAOYSA-N |
| SMILES | CC(C(C1=CC=CC=C1)Cl)NC.Cl |
Computed by PubChem (NCBI)