CAS 94133-42-3 appears in our catalog under these names: Chloropseudoephedrine HCl, (+)-Chloropseudoephedrine Hydrochloride (~90%), (+)–Chloropseudoephedrine (hydrochloride). Offered by: Chemat Brand, TRC, GLPBio. Available pack sizes: on request, 100mg, 1mg, 5mg, 500μg.
(1S,2S)-1-chloro-N-methyl-1-phenylpropan-2-amine;hydrochloride (CAS 94133-42-3) is a chemical compound with the molecular formula C10H15Cl2N and a molecular weight of 220.14 g/mol. IUPAC name: (1S,2S)-1-chloro-N-methyl-1-phenylpropan-2-amine;hydrochloride. InChIKey: ICZRAESMLGJTOQ-KXNXZCPBSA-N.
| Molecular formula | C10H15Cl2N |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | (1S,2S)-1-chloro-N-methyl-1-phenylpropan-2-amine;hydrochloride |
| InChIKey | ICZRAESMLGJTOQ-KXNXZCPBSA-N |
| SMILES | C[C@@H]([C@H](C1=CC=CC=C1)Cl)NC.Cl |
Computed by PubChem (NCBI)