CAS 2544-31-2 appears in our catalog under these names: H–Cys(pMeOBzl)–OH, H-L-Cys(Mob)-OH, H-Cys(pMeOBzl)-OH 95%, S-(4-Methoxybenzyl)-L-cysteine, 95%, 95%, H-Cys(pMeOBzl)-OH, 98.18%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 25g, 5g, 1g, 100g, 100 g, 25 g, 10g.
(2R)-2-amino-3-[(4-methoxyphenyl)methylsulfanyl]propanoic acid (CAS 2544-31-2) is a chemical compound with the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. IUPAC name: (2R)-2-amino-3-[(4-methoxyphenyl)methylsulfanyl]propanoic acid. InChIKey: PQPZSPJVMUCVAQ-JTQLQIEISA-N.
| Molecular formula | C11H15NO3S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | (2R)-2-amino-3-[(4-methoxyphenyl)methylsulfanyl]propanoic acid |
| InChIKey | PQPZSPJVMUCVAQ-JTQLQIEISA-N |
| SMILES | COC1=CC=C(C=C1)CSC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)