Products 2546513-31-7
CAS 2546513-31-7 appears in our catalog under these names: N3Ac–OPhOMe, N3Ac-OPhOMe, N3Ac-OPhOMe, 98.21%, 4-Methoxyphenyl 2-azidoacetate, 98%. Offered by: GLPBio, Iris Biotech, MedChemExpress, BLDpharm. Available pack sizes: 1mg, 10mg, 5mg, 250mg, 1g, 5g, 5 mg, 50 mg.
(4-methoxyphenyl) 2-azidoacetate (CAS 2546513-31-7) is a chemical compound with the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. IUPAC name: (4-methoxyphenyl) 2-azidoacetate. InChIKey: CBCXKHGBUBDDQO-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | (4-methoxyphenyl) 2-azidoacetate |
| InChIKey | CBCXKHGBUBDDQO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC(=O)CN=[N+]=[N-] |
Computed by PubChem (NCBI)