CAS 25474-85-5 appears in our catalog under these names: 4–Methoxybenzyloxycarbonyl azide, 4-METHOXYBENZYLOXYCARBONYL AZIDE, 95%, (diazyn-1-ium-1-yl)({[(4-methoxyphenyl)methoxy]carbonyl})azanide, ≥95%. Offered by: GLPBio, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 250mg, 5G.
(4-methoxyphenyl)methyl N-diazocarbamate (CAS 25474-85-5) is a chemical compound with the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. IUPAC name: (4-methoxyphenyl)methyl N-diazocarbamate. InChIKey: NQBRFIXRZDTIRQ-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | (4-methoxyphenyl)methyl N-diazocarbamate |
| InChIKey | NQBRFIXRZDTIRQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)COC(=O)N=[N+]=[N-] |
Computed by PubChem (NCBI)