Products 25589-49-5

CAS 25589-49-5 is the registry number for 4-((2-Methyl-5-nitrophenyl)amino)-4-oxobutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(2-methyl-5-nitroanilino)-4-oxobutanoic acid (CAS 25589-49-5) is a chemical compound with the molecular formula C11H12N2O5 and a molecular weight of 252.22 g/mol. IUPAC name: 4-(2-methyl-5-nitroanilino)-4-oxobutanoic acid. InChIKey: PHSZXRAMYNBQCH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12N2O5
Molecular weight252.22 g/mol
IUPAC name4-(2-methyl-5-nitroanilino)-4-oxobutanoic acid
InChIKeyPHSZXRAMYNBQCH-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)[N+](=O)[O-])NC(=O)CCC(=O)O

Computed by PubChem (NCBI)