CAS 25658-36-0 appears in our catalog under these names: 2,4-dimethyl pyridine-2,4-dicarboxylate, 98%, Dimethyl pyridine-2,4-dicarboxylate 98%, Dimethyl pyridine-2,4-dicarboxylate, 98%, 98%, Dimethyl pyridine-2,4-dicarboxylate, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
Dimethyl pyridine-2,4-dicarboxylate (CAS 25658-36-0) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: dimethyl pyridine-2,4-dicarboxylate. InChIKey: TVKOFNSTLWFQHY-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | dimethyl pyridine-2,4-dicarboxylate |
| InChIKey | TVKOFNSTLWFQHY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC=C1)C(=O)OC |
Computed by PubChem (NCBI)