Products 2567495-43-4
CAS 2567495-43-4 is the registry number for 1-(2,3-Difluoro-4-methylphenyl)methanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
(2,3-difluoro-4-methylphenyl)methanamine;hydrochloride (CAS 2567495-43-4) is a chemical compound with the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. IUPAC name: (2,3-difluoro-4-methylphenyl)methanamine;hydrochloride. InChIKey: CZBIDEYRDLNFQV-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF2N |
|---|---|
| Molecular weight | 193.62 g/mol |
| IUPAC name | (2,3-difluoro-4-methylphenyl)methanamine;hydrochloride |
| InChIKey | CZBIDEYRDLNFQV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)CN)F)F.Cl |
Computed by PubChem (NCBI)