CAS 25698-23-1 appears in our catalog under these names: (R)-2-Amino-2-(3-methoxyphenyl)acetic acid, 95%, H-D-Phg(3-OMe)-OH, 95%. Offered by: AmBeed. Available pack sizes: 5g, 250mg, 1g.
(2R)-2-amino-2-(3-methoxyphenyl)acetic acid (CAS 25698-23-1) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: (2R)-2-amino-2-(3-methoxyphenyl)acetic acid. InChIKey: UMKVNPOZWRHJPM-MRVPVSSYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | (2R)-2-amino-2-(3-methoxyphenyl)acetic acid |
| InChIKey | UMKVNPOZWRHJPM-MRVPVSSYSA-N |
| SMILES | COC1=CC=CC(=C1)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)