CAS 7314-43-4 appears in our catalog under these names: Amino(3-methoxyphenyl)acetic acid, 96%, 2-Amino-2-(3-methoxyphenyl)acetic acid, 96%, 2–Amino–2–(3–methoxyphenyl)acetic acid, 2-Amino-2-(3-methoxyphenyl)acetic acid, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100mg, 250mg.
2-amino-2-(3-methoxyphenyl)acetic acid (CAS 7314-43-4) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-amino-2-(3-methoxyphenyl)acetic acid. InChIKey: UMKVNPOZWRHJPM-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-amino-2-(3-methoxyphenyl)acetic acid |
| InChIKey | UMKVNPOZWRHJPM-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C(C(=O)O)N |
Computed by PubChem (NCBI)