CAS 25812-80-0 appears in our catalog under these names: 6,7–Dibromobenzo(1,4)dioxan, 6,7-Dibromo-2,3-dihydrobenzo[b][1,4]dioxine 97%, 6,7-Dibromo-2,3-dihydro-1,4-benzodioxin, 97%, 97%, 6,7-Dibromo-2,3-dihydrobenzo[b][1,4]dioxine, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 10g.
6,7-dibromo-2,3-dihydro-1,4-benzodioxine (CAS 25812-80-0) is a chemical compound with the molecular formula C8H6Br2O2 and a molecular weight of 293.94 g/mol. IUPAC name: 6,7-dibromo-2,3-dihydro-1,4-benzodioxine. InChIKey: FTSJTAIEXFMURW-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O2 |
|---|---|
| Molecular weight | 293.94 g/mol |
| IUPAC name | 6,7-dibromo-2,3-dihydro-1,4-benzodioxine |
| InChIKey | FTSJTAIEXFMURW-UHFFFAOYSA-N |
| SMILES | C1COC2=CC(=C(C=C2O1)Br)Br |
Computed by PubChem (NCBI)