Products 2581232-23-5

CAS 2581232-23-5 is the registry number for Methyl 6-chloro-5-cyano-3,4-dimethylpicolinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 6-chloro-5-cyano-3,4-dimethylpyridine-2-carboxylate (CAS 2581232-23-5) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: methyl 6-chloro-5-cyano-3,4-dimethylpyridine-2-carboxylate. InChIKey: AFZUCNAYEUKUON-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9ClN2O2
Molecular weight224.64 g/mol
IUPAC namemethyl 6-chloro-5-cyano-3,4-dimethylpyridine-2-carboxylate
InChIKeyAFZUCNAYEUKUON-UHFFFAOYSA-N
SMILESCC1=C(C(=NC(=C1C#N)Cl)C(=O)OC)C

Computed by PubChem (NCBI)