CAS 2581232-23-5 is the registry number for Methyl 6-chloro-5-cyano-3,4-dimethylpicolinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-chloro-5-cyano-3,4-dimethylpyridine-2-carboxylate (CAS 2581232-23-5) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: methyl 6-chloro-5-cyano-3,4-dimethylpyridine-2-carboxylate. InChIKey: AFZUCNAYEUKUON-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | methyl 6-chloro-5-cyano-3,4-dimethylpyridine-2-carboxylate |
| InChIKey | AFZUCNAYEUKUON-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=C1C#N)Cl)C(=O)OC)C |
Computed by PubChem (NCBI)