Products 258332-42-2
CAS 258332-42-2 appears in our catalog under these names: 2-{((4-Chlorophenyl)methyl)({((9H-fluoren-9-yl)methoxy)carbonyl})amino}acetic acid, N-Fmoc-4-chlorobenzyl-glycine, 98%. Offered by: Biosynth, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg, 5g, 10g.
2-[(4-chlorophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid (CAS 258332-42-2) is a chemical compound with the molecular formula C24H20ClNO4 and a molecular weight of 421.9 g/mol. IUPAC name: 2-[(4-chlorophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid. InChIKey: IWDQSRGBOLDOST-UHFFFAOYSA-N.
| Molecular formula | C24H20ClNO4 |
|---|---|
| Molecular weight | 421.9 g/mol |
| IUPAC name | 2-[(4-chlorophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid |
| InChIKey | IWDQSRGBOLDOST-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N(CC4=CC=C(C=C4)Cl)CC(=O)O |
Computed by PubChem (NCBI)