Products 2584882-95-9
CAS 2584882-95-9 is the registry number for rel-(3AR,6aS)-5-acetyltetrahydropyrrolo[3,4-c]pyrrole-1,3(2H,3aH)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3aR,6aS)-5-acetyl-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione (CAS 2584882-95-9) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: (3aR,6aS)-5-acetyl-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione. InChIKey: ZJHBLJMFUDFOFM-OLQVQODUSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | (3aR,6aS)-5-acetyl-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione |
| InChIKey | ZJHBLJMFUDFOFM-OLQVQODUSA-N |
| SMILES | CC(=O)N1C[C@@H]2[C@H](C1)C(=O)NC2=O |
Computed by PubChem (NCBI)