CAS 258861-91-5 is the registry number for 2–Bromo–5–(Bromomethyl)Benzoic Acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
2-bromo-5-(bromomethyl)benzoic acid (CAS 258861-91-5) is a chemical compound with the molecular formula C8H6Br2O2 and a molecular weight of 293.94 g/mol. IUPAC name: 2-bromo-5-(bromomethyl)benzoic acid. InChIKey: RQUDWCHBLVODNW-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O2 |
|---|---|
| Molecular weight | 293.94 g/mol |
| IUPAC name | 2-bromo-5-(bromomethyl)benzoic acid |
| InChIKey | RQUDWCHBLVODNW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CBr)C(=O)O)Br |
Computed by PubChem (NCBI)