Products 258861-91-5

CAS 258861-91-5 is the registry number for 2–Bromo–5–(Bromomethyl)Benzoic Acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-bromo-5-(bromomethyl)benzoic acid (CAS 258861-91-5) is a chemical compound with the molecular formula C8H6Br2O2 and a molecular weight of 293.94 g/mol. IUPAC name: 2-bromo-5-(bromomethyl)benzoic acid. InChIKey: RQUDWCHBLVODNW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6Br2O2
Molecular weight293.94 g/mol
IUPAC name2-bromo-5-(bromomethyl)benzoic acid
InChIKeyRQUDWCHBLVODNW-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1CBr)C(=O)O)Br

Computed by PubChem (NCBI)