CAS 25912-37-2 appears in our catalog under these names: 3-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione, 98%, 98%, 3-Methyl-5-nitropyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-methyl-5-nitro-1H-pyrimidine-2,4-dione (CAS 25912-37-2) is a chemical compound with the molecular formula C5H5N3O4 and a molecular weight of 171.11 g/mol. IUPAC name: 3-methyl-5-nitro-1H-pyrimidine-2,4-dione. InChIKey: CZQHCPSSXFKBNP-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O4 |
|---|---|
| Molecular weight | 171.11 g/mol |
| IUPAC name | 3-methyl-5-nitro-1H-pyrimidine-2,4-dione |
| InChIKey | CZQHCPSSXFKBNP-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=CNC1=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)