CAS 25917-90-2 appears in our catalog under these names: 2–Methoxy–5–nitrobenzene–1,4–diamine, 2-Methoxy-5-nitrobenzene-1,4-diamine, 98%, 2-Methoxy-5-nitrobenzene-1,4-diamine, 98%, 98%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-methoxy-5-nitrobenzene-1,4-diamine (CAS 25917-90-2) is a chemical compound with the molecular formula C7H9N3O3 and a molecular weight of 183.16 g/mol. IUPAC name: 2-methoxy-5-nitrobenzene-1,4-diamine. InChIKey: YXHNYYAGVDNJIK-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O3 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 2-methoxy-5-nitrobenzene-1,4-diamine |
| InChIKey | YXHNYYAGVDNJIK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1N)[N+](=O)[O-])N |
Computed by PubChem (NCBI)