CAS 25945-96-4 appears in our catalog under these names: 2–(Benzyloxy)–4–nitroaniline, 2-(Benzyloxy)-4-nitroaniline, 95%, 2-(Benzyloxy)-4-nitroaniline, 95%, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-nitro-2-phenylmethoxyaniline (CAS 25945-96-4) is a chemical compound with the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. IUPAC name: 4-nitro-2-phenylmethoxyaniline. InChIKey: OTBQGZCBYVALOL-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | 4-nitro-2-phenylmethoxyaniline |
| InChIKey | OTBQGZCBYVALOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)