Products 25991-81-5
CAS 25991-81-5 is the registry number for Swertinin. Offered by: MedChemExpress. Available pack sizes: Get quote.
6,8-dihydroxy-1,2-dimethoxyxanthen-9-one (CAS 25991-81-5) is a chemical compound with the molecular formula C15H12O6 and a molecular weight of 288.25 g/mol. IUPAC name: 6,8-dihydroxy-1,2-dimethoxyxanthen-9-one. InChIKey: BEPQKAFKFDCXTR-UHFFFAOYSA-N.
| Molecular formula | C15H12O6 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | 6,8-dihydroxy-1,2-dimethoxyxanthen-9-one |
| InChIKey | BEPQKAFKFDCXTR-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)OC3=CC(=CC(=C3C2=O)O)O)OC |
Computed by PubChem (NCBI)