CAS 26050-64-6 appears in our catalog under these names: 4-Bromo-3,5-dimethoxybenzoic acid methyl ester, Methyl 4-bromo-3,5-dimethoxybenzoate 97%, Methyl 4-Bromo-3,5-Dimethoxybenzoate, 98%, 98%, METHYL 4-BROMO-3,5-DIMETHOXYBENZOATE, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 50g, 100g, 500g, 1g.
Methyl 4-bromo-3,5-dimethoxybenzoate (CAS 26050-64-6) is a chemical compound with the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. IUPAC name: methyl 4-bromo-3,5-dimethoxybenzoate. InChIKey: DBPNSECLVZPWET-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO4 |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | methyl 4-bromo-3,5-dimethoxybenzoate |
| InChIKey | DBPNSECLVZPWET-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1Br)OC)C(=O)OC |
Computed by PubChem (NCBI)