Products 2605229-99-8
CAS 2605229-99-8 is the registry number for 9-Bromo-1,5,6,10b-tetrahydropyrrolo[2,1-a]isoquinolin-3(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
9-bromo-2,5,6,10b-tetrahydro-1H-pyrrolo[2,1-a]isoquinolin-3-one (CAS 2605229-99-8) is a chemical compound with the molecular formula C12H12BrNO and a molecular weight of 266.13 g/mol. IUPAC name: 9-bromo-2,5,6,10b-tetrahydro-1H-pyrrolo[2,1-a]isoquinolin-3-one. InChIKey: PRMHPZWEZNJSHA-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO |
|---|---|
| Molecular weight | 266.13 g/mol |
| IUPAC name | 9-bromo-2,5,6,10b-tetrahydro-1H-pyrrolo[2,1-a]isoquinolin-3-one |
| InChIKey | PRMHPZWEZNJSHA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N2C1C3=C(CC2)C=CC(=C3)Br |
Computed by PubChem (NCBI)