CAS 261635-83-0 appears in our catalog under these names: 6–Chloro–2–(trifluoromethyl)nicotinic acid, 6-Chloro-2-(trifluoromethyl)nicotinic acid, 6-Chloro-2-(trifluoromethyl)nicotinic acid, 95%, 95%, 6-Chloro-2-(trifluoromethyl)nicotinic acid, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g, 2,5g, 10g, 100g.
6-chloro-2-(trifluoromethyl)pyridine-3-carboxylic acid (CAS 261635-83-0) is a chemical compound with the molecular formula C7H3ClF3NO2 and a molecular weight of 225.55 g/mol. IUPAC name: 6-chloro-2-(trifluoromethyl)pyridine-3-carboxylic acid. InChIKey: UDYRRHUXOXTWBD-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO2 |
|---|---|
| Molecular weight | 225.55 g/mol |
| IUPAC name | 6-chloro-2-(trifluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | UDYRRHUXOXTWBD-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)