Products 2618458-94-7
CAS 2618458-94-7 is the registry number for 3,5-di(Hydrazinecarbonyl)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3,5-bis(hydrazinecarbonyl)benzoic acid (CAS 2618458-94-7) is a chemical compound with the molecular formula C9H10N4O4 and a molecular weight of 238.20 g/mol. IUPAC name: 3,5-bis(hydrazinecarbonyl)benzoic acid. InChIKey: NCOOXUWSLMLQSK-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O4 |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | 3,5-bis(hydrazinecarbonyl)benzoic acid |
| InChIKey | NCOOXUWSLMLQSK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)NN)C(=O)O)C(=O)NN |
Computed by PubChem (NCBI)
Synonyms:
3,5-di(Hydrazinecarbonyl)benzoic acid