CAS 261951-72-8 appears in our catalog under these names: 3–(3–Fluoro–4–methylphenyl)acrylic acid, 3-(3-Fluoro-4-methylphenyl)acrylic acid 97% (E), 3-Fluoro-4-methylcinnamic acid, 97% (E), 97% (E), 3-Fluoro-4-methylcinnamic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
(E)-3-(3-fluoro-4-methylphenyl)prop-2-enoic acid (CAS 261951-72-8) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: (E)-3-(3-fluoro-4-methylphenyl)prop-2-enoic acid. InChIKey: DVZABKDWMCAVGE-SNAWJCMRSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | (E)-3-(3-fluoro-4-methylphenyl)prop-2-enoic acid |
| InChIKey | DVZABKDWMCAVGE-SNAWJCMRSA-N |
| SMILES | CC1=C(C=C(C=C1)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)