CAS 26209-27-8 is the registry number for 1-(2,4-Dimethylphenyl)-1H-imidazole-2-thiol. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
3-(2,4-dimethylphenyl)-1H-imidazole-2-thione (CAS 26209-27-8) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: 3-(2,4-dimethylphenyl)-1H-imidazole-2-thione. InChIKey: NRDBUFOGZXXCRC-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | 3-(2,4-dimethylphenyl)-1H-imidazole-2-thione |
| InChIKey | NRDBUFOGZXXCRC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C=CNC2=S)C |
Computed by PubChem (NCBI)