Products 26213-95-6
CAS 26213-95-6 appears in our catalog under these names: Heteropeucenin 7–methyl ether, Heteropeucenin 7-methyl ether, 90.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 1 mg.
5-hydroxy-7-methoxy-2-methyl-8-(3-methylbut-2-enyl)chromen-4-one (CAS 26213-95-6) is a chemical compound with the molecular formula C16H18O4 and a molecular weight of 274.31 g/mol. IUPAC name: 5-hydroxy-7-methoxy-2-methyl-8-(3-methylbut-2-enyl)chromen-4-one. InChIKey: KVNRDSLYCOJCRD-UHFFFAOYSA-N.
| Molecular formula | C16H18O4 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | 5-hydroxy-7-methoxy-2-methyl-8-(3-methylbut-2-enyl)chromen-4-one |
| InChIKey | KVNRDSLYCOJCRD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(O1)C(=C(C=C2O)OC)CC=C(C)C |
Computed by PubChem (NCBI)