Products 2633634-64-5
CAS 2633634-64-5 is the registry number for BRD9 ligand-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,6-dimethoxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)benzaldehyde (CAS 2633634-64-5) is a chemical compound with the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. IUPAC name: 2,6-dimethoxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)benzaldehyde. InChIKey: VKPDGIMVRUZJMW-UHFFFAOYSA-N.
| Molecular formula | C17H19NO4 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | 2,6-dimethoxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)benzaldehyde |
| InChIKey | VKPDGIMVRUZJMW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(C=C1C2=CC(=C(C(=C2)OC)C=O)OC)C)C |
Computed by PubChem (NCBI)