Products 263396-40-3
CAS 263396-40-3 is the registry number for 2-Amino-3-(2-cyanophenyl)propanoic acid, 95+%. Offered by: AmBeed. Available pack sizes: 25g.
2-amino-3-(2-cyanophenyl)propanoic acid (CAS 263396-40-3) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 2-amino-3-(2-cyanophenyl)propanoic acid. InChIKey: OCDHPLVCNWBKJN-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 2-amino-3-(2-cyanophenyl)propanoic acid |
| InChIKey | OCDHPLVCNWBKJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(C(=O)O)N)C#N |
Computed by PubChem (NCBI)