Products 263396-42-5
CAS 263396-42-5 appears in our catalog under these names: L-2-Cyanophenylalanine, 98%, (S)–2–Amino–3–(2–cyanophenyl)propanoic acid, L-2-Cyanophenylalanine, 97%, 97%, (S)-2-Amino-3-(2-cyanophenyl)propanoic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
(2S)-2-amino-3-(2-cyanophenyl)propanoic acid (CAS 263396-42-5) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: (2S)-2-amino-3-(2-cyanophenyl)propanoic acid. InChIKey: OCDHPLVCNWBKJN-VIFPVBQESA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | (2S)-2-amino-3-(2-cyanophenyl)propanoic acid |
| InChIKey | OCDHPLVCNWBKJN-VIFPVBQESA-N |
| SMILES | C1=CC=C(C(=C1)C[C@@H](C(=O)O)N)C#N |
Computed by PubChem (NCBI)
Synonyms:
L-2-Cyanophenylalanine, 2-Cyano-L-Phenylalanine, H-Phe(2-CN)-OH, (S)-2-Amino-3-(2-cyanophenyl)propanoic acid, L-2-Cyanophe, (2S)-2-amino-3-(2-cyanophenyl)propanoic acid, L-Phenylalanine, 2-cyano-, (2S)-2-Azaniumyl-3-(2-cyanophenyl)propanoate, L-2-Cyanophenylalarine, (s)-o-cyano-phenylalanine