CAS 26358-37-2 appears in our catalog under these names: 5-Amino-2,4-dichlorobenzamide, 95%, 5-Amino-2,4-dichlorobenzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
5-amino-2,4-dichlorobenzamide (CAS 26358-37-2) is a chemical compound with the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. IUPAC name: 5-amino-2,4-dichlorobenzamide. InChIKey: APRTXLXKTLCGKJ-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | 5-amino-2,4-dichlorobenzamide |
| InChIKey | APRTXLXKTLCGKJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N)Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)