CAS 26377-17-3 appears in our catalog under these names: Ethyl 3-oxo-3-(pyridin-4-yl)propanoate 98%, Ethyl 3-Oxo-3-(4-pyridyl)propionate, >98.0%(GC)(T), Ethyl isonicotinylacetate, Ethyl isonicotinoylacetate, 95%, Ethyl Isonicotinoylacetate, 97%, 97%. Offered by: Ambeed, TCI, GLPBio, Thermo Scientific (Acros), Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 2.5g.
Ethyl 3-oxo-3-pyridin-4-ylpropanoate (CAS 26377-17-3) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: ethyl 3-oxo-3-pyridin-4-ylpropanoate. InChIKey: PCJNYGPKMQQCPX-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | ethyl 3-oxo-3-pyridin-4-ylpropanoate |
| InChIKey | PCJNYGPKMQQCPX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC=NC=C1 |
Computed by PubChem (NCBI)