CAS 26383-05-1 is the registry number for 3’-Deoxy-3’-α-C-methyladenosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-4-methyloxolan-3-ol (CAS 26383-05-1) is a chemical compound with the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. IUPAC name: (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-4-methyloxolan-3-ol. InChIKey: IUICAGSHIJKNDR-HUKYDQBMSA-N.
| Molecular formula | C11H15N5O3 |
|---|---|
| Molecular weight | 265.27 g/mol |
| IUPAC name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-4-methyloxolan-3-ol |
| InChIKey | IUICAGSHIJKNDR-HUKYDQBMSA-N |
| SMILES | C[C@@H]1[C@H](O[C@H]([C@@H]1O)N2C=NC3=C(N=CN=C32)N)CO |
Computed by PubChem (NCBI)